C15H17ClO4S — CID 82177287
3-chloro-5-ethoxy-6-(2-methylpropoxy)-1-benzothiophene-2-carboxylic acid (PubChem CID 82177287) has the molecular formula C15H17ClO4S and a molecular weight of 328.82 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-6-(2-methylpropoxy)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3-chloro-5-ethoxy-6-(2-methylpropoxy)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 82177287 |
| Molecular Formula | C15H17ClO4S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-chloro-5-ethoxy-6-(2-methylpropoxy)-1-benzothiophene-2-carboxylic acid |
| SMILES | CCOc1cc2c(Cl)c(C(=O)O)sc2cc1OCC(C)C |
| InChI | InChI=1S/C15H17ClO4S/c1-4-19-10-5-9-12(6-11(10)20-7-8(2)3)21-14(13(9)16)15(17)18/h5-6,8H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | WGHRLTGNOHWFNR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |