C11H10ClNO3S — CID 70525863
3-chloro-5,6-dimethoxy-1-benzothiophene-2-carboxamide (PubChem CID 70525863) has the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. Its IUPAC name is 3-chloro-5,6-dimethoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-5,6-dimethoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 70525863 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 3-chloro-5,6-dimethoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc2sc(C(N)=O)c(Cl)c2cc1OC |
| InChI | InChI=1S/C11H10ClNO3S/c1-15-6-3-5-8(4-7(6)16-2)17-10(9(5)12)11(13)14/h3-4H,1-2H3,(H2,13,14) |
| InChIKey | HTJQVMYXJUCNEY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |