C14H14ClNO4S — CID 67094205
(3-chloro-6-hydroxy-5-methoxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone (PubChem CID 67094205) has the molecular formula C14H14ClNO4S and a molecular weight of 327.79 g/mol. Its IUPAC name is (3-chloro-6-hydroxy-5-methoxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone.
| Compound Name | (3-chloro-6-hydroxy-5-methoxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 67094205 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (3-chloro-6-hydroxy-5-methoxy-1-benzothiophen-2-yl)-morpholin-4-ylmethanone |
| SMILES | COc1cc2c(Cl)c(C(=O)N3CCOCC3)sc2cc1O |
| InChI | InChI=1S/C14H14ClNO4S/c1-19-10-6-8-11(7-9(10)17)21-13(12(8)15)14(18)16-2-4-20-5-3-16/h6-7,17H,2-5H2,1H3 |
| InChIKey | DDRABKJMLQYVCM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |