C22H28BNO4 — CID 117065131
2-[(E)-2-phenylethenyl]-6-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 117065131) has the molecular formula C22H28BNO4 and a molecular weight of 381.28 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-6-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[(E)-2-phenylethenyl]-6-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 117065131 |
| Molecular Formula | C22H28BNO4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-6-[(1R,2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | C[C@H]1C(N2CC(=O)OB(/C=C/c3ccccc3)OC(=O)C2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C22H28BNO4/c1-15-18-11-17(22(18,2)3)12-19(15)24-13-20(25)27-23(28-21(26)14-24)10-9-16-7-5-4-6-8-16/h4-10,15,17-19H,11-14H2,1-3H3/b10-9+/t15-,17+,18-,19?/m1/s1 |
| InChIKey | OEDNJAGCEJKABP-BYJVCMPJSA-N |
| XLogP | 3.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|