C22H28BNO5 — CID 162410144
(2S)-2-[4,8-dioxo-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocan-2-yl]-2-phenylacetaldehyde (PubChem CID 162410144) has the molecular formula C22H28BNO5 and a molecular weight of 397.28 g/mol. Its IUPAC name is (2S)-2-[4,8-dioxo-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocan-2-yl]-2-phenylacetaldehyde.
| Compound Name | (2S)-2-[4,8-dioxo-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocan-2-yl]-2-phenylacetaldehyde |
|---|---|
| PubChem CID | 162410144 |
| Molecular Formula | C22H28BNO5 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2S)-2-[4,8-dioxo-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3,6,2-dioxazaborocan-2-yl]-2-phenylacetaldehyde |
| SMILES | C[C@H]1[C@H](N2CC(=O)OB([C@H](C=O)c3ccccc3)OC(=O)C2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C22H28BNO5/c1-14-17-9-16(22(17,2)3)10-19(14)24-11-20(26)28-23(29-21(27)12-24)18(13-25)15-7-5-4-6-8-15/h4-8,13-14,16-19H,9-12H2,1-3H3/t14-,16+,17-,18-,19-/m1/s1 |
| InChIKey | WUOJBGCAAUMVJG-RSRPTUBKSA-N |
| XLogP | 2.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|