C23H30BNO4 — CID 153438560
2-methyl-2-[(E)-2-phenylethenyl]-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-dioxa-6-aza-2-boranuidacyclooctane-4,8-dione (PubChem CID 153438560) has the molecular formula C23H30BNO4 and a molecular weight of 395.31 g/mol. Its IUPAC name is 2-methyl-2-[(E)-2-phenylethenyl]-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-dioxa-6-aza-2-boranuidacyclooctane-4,8-dione.
| Compound Name | 2-methyl-2-[(E)-2-phenylethenyl]-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-dioxa-6-aza-2-boranuidacyclooctane-4,8-dione |
|---|---|
| PubChem CID | 153438560 |
| Molecular Formula | C23H30BNO4 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-methyl-2-[(E)-2-phenylethenyl]-6-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-dioxa-6-aza-2-boranuidacyclooctane-4,8-dione |
| SMILES | [CH2+][B-]1(/C=C/c2ccccc2)OC(=O)CN([C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)CC(=O)O1 |
| InChI | InChI=1S/C23H30BNO4/c1-16-19-12-18(23(19,2)3)13-20(16)25-14-21(26)28-24(4,29-22(27)15-25)11-10-17-8-6-5-7-9-17/h5-11,16,18-20H,4,12-15H2,1-3H3/b11-10+/t16-,18+,19-,20-/m1/s1 |
| InChIKey | NXWQVHREGYSBNE-DPABANGLSA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|