C23H33FO5 — CID 117066148
[(5R,17R)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 117066148) has the molecular formula C23H33FO5 and a molecular weight of 408.51 g/mol. Its IUPAC name is [(5R,17R)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(5R,17R)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 117066148 |
| Molecular Formula | C23H33FO5 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | [(5R,17R)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CCC2C3CC(F)[C@@]4(O)CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C23H33FO5/c1-13(25)23(29-14(2)26)10-7-18-16-11-19(24)22(28)12-15(27)5-8-20(22,3)17(16)6-9-21(18,23)4/h16-19,28H,5-12H2,1-4H3/t16?,17?,18?,19?,20?,21?,22-,23-/m0/s1 |
| InChIKey | SZTAYWGUFKACAE-GRNHBQNCSA-N |
| XLogP | 3.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |