C21H29FO4 — CID 154311773
(5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-1,2,4,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 154311773) has the molecular formula C21H29FO4 and a molecular weight of 364.46 g/mol. Its IUPAC name is (5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-1,2,4,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-1,2,4,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 154311773 |
| Molecular Formula | C21H29FO4 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (5R,6R,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluoro-5-hydroxy-10,13-dimethyl-1,2,4,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C[C@@H](F)[C@@]4(O)CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C |
| InChI | InChI=1S/C21H29FO4/c1-11(23)14-4-5-15-13-8-17(22)21(26)9-12(24)6-7-20(21,3)18(13)16(25)10-19(14,15)2/h13-15,17-18,26H,4-10H2,1-3H3/t13-,14+,15-,17+,18+,19+,20+,21-/m0/s1 |
| InChIKey | CQBCFSPAAFBIDX-NLUHDMOXSA-N |
| XLogP | 3.05 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |