C24H34N6O — CID 1170682
3-[[(1-tert-butyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethyl-1H-quinolin-2-one (PubChem CID 1170682) has the molecular formula C24H34N6O and a molecular weight of 422.58 g/mol. Its IUPAC name is 3-[[(1-tert-butyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethyl-1H-quinolin-2-one.
| Compound Name | 3-[[(1-tert-butyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1170682 |
| Molecular Formula | C24H34N6O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 3-[[(1-tert-butyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethyl-1H-quinolin-2-one |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3nnnn3C(C)(C)C)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C24H34N6O/c1-5-17-11-12-21-18(13-17)14-19(23(31)25-21)15-29(20-9-7-6-8-10-20)16-22-26-27-28-30(22)24(2,3)4/h11-14,20H,5-10,15-16H2,1-4H3,(H,25,31) |
| InChIKey | FJZBHPOMARVANU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |