C26H46O6Si — CID 117070769
(3aR,5R,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E)-2-[(2R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethenyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 117070769) has the molecular formula C26H46O6Si and a molecular weight of 482.73 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E)-2-[(2R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethenyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E)-2-[(2R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethenyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 117070769 |
| Molecular Formula | C26H46O6Si |
| Molecular Weight | 482.73 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E)-2-[(2R)-2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]ethenyl]-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](CCO[Si](C)(C)C(C)(C)C)[C@](O)(/C=C/C34CCC(C[C@H]3O)C4(C)C)[C@H]2O1 |
| InChI | InChI=1S/C26H46O6Si/c1-22(2,3)33(8,9)29-15-11-19-26(28,20-21(30-19)32-24(6,7)31-20)14-13-25-12-10-17(16-18(25)27)23(25,4)5/h13-14,17-21,27-28H,10-12,15-16H2,1-9H3/b14-13+/t17?,18-,19-,20+,21-,25?,26-/m1/s1 |
| InChIKey | GSZXMOZWPMPAMT-VVDXPKSGSA-N |
| XLogP | 4.75 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|