C29H46O5Si — CID 117070774
(2R,4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)ethenyl]-2-phenyl-1,3-dioxan-5-ol (PubChem CID 117070774) has the molecular formula C29H46O5Si and a molecular weight of 502.77 g/mol. Its IUPAC name is (2R,4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)ethenyl]-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2R,4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)ethenyl]-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 117070774 |
| Molecular Formula | C29H46O5Si |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | (2R,4S,5S)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-[(E)-2-(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)ethenyl]-2-phenyl-1,3-dioxan-5-ol |
| SMILES | CC1(C)C2CCC1(/C=C/[C@]1(O)CO[C@@H](c3ccccc3)O[C@H]1CCO[Si](C)(C)C(C)(C)C)C(O)C2 |
| InChI | InChI=1S/C29H46O5Si/c1-26(2,3)35(6,7)33-18-14-24-29(31,20-32-25(34-24)21-11-9-8-10-12-21)17-16-28-15-13-22(19-23(28)30)27(28,4)5/h8-12,16-17,22-25,30-31H,13-15,18-20H2,1-7H3/b17-16+/t22?,23?,24-,25+,28?,29-/m0/s1 |
| InChIKey | SHBPVCOXIGBEOE-PWHHLTKYSA-N |
| XLogP | 5.99 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|