C29H30N4O — CID 117073238
2-amino-1-[3-[(4-methylisoquinolin-5-yl)amino]piperidin-1-yl]-2-(4-phenylphenyl)ethanone (PubChem CID 117073238) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 2-amino-1-[3-[(4-methylisoquinolin-5-yl)amino]piperidin-1-yl]-2-(4-phenylphenyl)ethanone.
| Compound Name | 2-amino-1-[3-[(4-methylisoquinolin-5-yl)amino]piperidin-1-yl]-2-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 117073238 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-amino-1-[3-[(4-methylisoquinolin-5-yl)amino]piperidin-1-yl]-2-(4-phenylphenyl)ethanone |
| SMILES | Cc1cncc2cccc(NC3CCCN(C(=O)C(N)c4ccc(-c5ccccc5)cc4)C3)c12 |
| InChI | InChI=1S/C29H30N4O/c1-20-17-31-18-24-9-5-11-26(27(20)24)32-25-10-6-16-33(19-25)29(34)28(30)23-14-12-22(13-15-23)21-7-3-2-4-8-21/h2-5,7-9,11-15,17-18,25,28,32H,6,10,16,19,30H2,1H3 |
| InChIKey | BEQFXIBLTOPQMW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |