C25H23FN4O — CID 117073640
1-benzyl-4-(2-fluorophenyl)-N-(1H-indazol-5-yl)pyrrolidine-3-carboxamide (PubChem CID 117073640) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-benzyl-4-(2-fluorophenyl)-N-(1H-indazol-5-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-4-(2-fluorophenyl)-N-(1H-indazol-5-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 117073640 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-benzyl-4-(2-fluorophenyl)-N-(1H-indazol-5-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)C1CN(Cc2ccccc2)CC1c1ccccc1F |
| InChI | InChI=1S/C25H23FN4O/c26-23-9-5-4-8-20(23)21-15-30(14-17-6-2-1-3-7-17)16-22(21)25(31)28-19-10-11-24-18(12-19)13-27-29-24/h1-13,21-22H,14-16H2,(H,27,29)(H,28,31) |
| InChIKey | HLRJCMSDYRLNPC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |