C29H27N3O — CID 156839438
(3S,4R)-1-benzyl-4-phenyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 156839438) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-4-phenyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-benzyl-4-phenyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 156839438 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (3S,4R)-1-benzyl-4-phenyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-c2cccnc2)c1)[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H27N3O/c33-29(31-26-15-7-13-24(17-26)25-14-8-16-30-18-25)28-21-32(19-22-9-3-1-4-10-22)20-27(28)23-11-5-2-6-12-23/h1-18,27-28H,19-21H2,(H,31,33)/t27-,28+/m0/s1 |
| InChIKey | ZSBOFOUCAXOGKD-WUFINQPMSA-N |
| XLogP | 5.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |