C17H19N3O — CID 166803782
(3R,4R)-4-methyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 166803782) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (3R,4R)-4-methyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-4-methyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166803782 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (3R,4R)-4-methyl-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | C[C@H]1CNC[C@@H]1C(=O)Nc1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C17H19N3O/c1-12-9-19-11-16(12)17(21)20-15-6-2-4-13(8-15)14-5-3-7-18-10-14/h2-8,10,12,16,19H,9,11H2,1H3,(H,20,21)/t12-,16-/m0/s1 |
| InChIKey | LXQTZADRUDPMLV-LRDDRELGSA-N |
| XLogP | 2.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |