C22H29N3O2 — CID 158312980
methane;4-(oxan-4-yl)-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 158312980) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is methane;4-(oxan-4-yl)-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | methane;4-(oxan-4-yl)-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 158312980 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | methane;4-(oxan-4-yl)-N-(3-pyridin-3-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | C.O=C(Nc1cccc(-c2cccnc2)c1)C1CNCC1C1CCOCC1 |
| InChI | InChI=1S/C21H25N3O2.CH4/c25-21(20-14-23-13-19(20)15-6-9-26-10-7-15)24-18-5-1-3-16(11-18)17-4-2-8-22-12-17;/h1-5,8,11-12,15,19-20,23H,6-7,9-10,13-14H2,(H,24,25);1H4 |
| InChIKey | GNXCFJMEZUQEKL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |