C23H19F7N4O5 — CID 117075979
(3S)-6-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 117075979) has the molecular formula C23H19F7N4O5 and a molecular weight of 564.41 g/mol. Its IUPAC name is (3S)-6-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S)-6-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 117075979 |
| Molecular Formula | C23H19F7N4O5 |
| Molecular Weight | 564.41 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | (3S)-6-fluoro-N-[4-(1H-pyrazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(Nc1ccc(-c2cn[nH]c2)cc1)[C@@H]1Cc2cc(F)ccc2CN1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H17FN4O.2C2HF3O2/c20-16-4-1-13-9-21-18(8-14(13)7-16)19(25)24-17-5-2-12(3-6-17)15-10-22-23-11-15;2*3-2(4,5)1(6)7/h1-7,10-11,18,21H,8-9H2,(H,22,23)(H,24,25);2*(H,6,7)/t18-;;/m0../s1 |
| InChIKey | VFQOOUSNHJMUFS-NTEVMMBTSA-N |
| XLogP | 4.14 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |