C27H32F3N5O5 — CID 46900592
N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-ethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 46900592) has the molecular formula C27H32F3N5O5 and a molecular weight of 563.58 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-ethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-ethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46900592 |
| Molecular Formula | C27H32F3N5O5 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]-4-(1H-pyrazol-4-yl)phenyl]-6-ethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc2c(c1)CC(C(=O)Nc1ccc(-c3cn[nH]c3)cc1OCCN(C)C)NC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H31N5O3.C2HF3O2/c1-4-32-21-7-5-18-14-26-23(12-19(18)11-21)25(31)29-22-8-6-17(20-15-27-28-16-20)13-24(22)33-10-9-30(2)3;3-2(4,5)1(6)7/h5-8,11,13,15-16,23,26H,4,9-10,12,14H2,1-3H3,(H,27,28)(H,29,31);(H,6,7) |
| InChIKey | UJUFFQZQYHHVMA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |