C22H22F3N5O4 — CID 117076311
6-ethoxy-N-[4-(2H-triazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 117076311) has the molecular formula C22H22F3N5O4 and a molecular weight of 477.44 g/mol. Its IUPAC name is 6-ethoxy-N-[4-(2H-triazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-ethoxy-N-[4-(2H-triazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 117076311 |
| Molecular Formula | C22H22F3N5O4 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 6-ethoxy-N-[4-(2H-triazol-4-yl)phenyl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1ccc2c(c1)CC(C(=O)Nc1ccc(-c3cn[nH]n3)cc1)NC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H21N5O2.C2HF3O2/c1-2-27-17-8-5-14-11-21-18(10-15(14)9-17)20(26)23-16-6-3-13(4-7-16)19-12-22-25-24-19;3-2(4,5)1(6)7/h3-9,12,18,21H,2,10-11H2,1H3,(H,23,26)(H,22,24,25);(H,6,7) |
| InChIKey | YBJZQCCSRFQXTJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |