C26H24BrN5O4S — CID 117076288
3-[4-[(2-bromophenyl)carbamothioylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 117076288) has the molecular formula C26H24BrN5O4S and a molecular weight of 582.48 g/mol. Its IUPAC name is 3-[4-[(2-bromophenyl)carbamothioylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 3-[4-[(2-bromophenyl)carbamothioylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 117076288 |
| Molecular Formula | C26H24BrN5O4S |
| Molecular Weight | 582.48 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | 3-[4-[(2-bromophenyl)carbamothioylamino]pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cccc(-n3cc(NC(=S)Nc4ccccc4Br)cn3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H24BrN5O4S/c1-34-22-12-17(13-23(35-2)24(22)36-3)29-25(33)16-7-6-8-19(11-16)32-15-18(14-28-32)30-26(37)31-21-10-5-4-9-20(21)27/h4-15H,1-3H3,(H,29,33)(H2,30,31,37) |
| InChIKey | PBOWGJXUZJAQRA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|