C26H37N7O — CID 117082914
N-cyclopropyl-4-[6-[2-[di(propan-2-yl)amino]ethylamino]-9-propan-2-ylpurin-8-yl]benzamide (PubChem CID 117082914) has the molecular formula C26H37N7O and a molecular weight of 463.63 g/mol. Its IUPAC name is N-cyclopropyl-4-[6-[2-[di(propan-2-yl)amino]ethylamino]-9-propan-2-ylpurin-8-yl]benzamide.
| Compound Name | N-cyclopropyl-4-[6-[2-[di(propan-2-yl)amino]ethylamino]-9-propan-2-ylpurin-8-yl]benzamide |
|---|---|
| PubChem CID | 117082914 |
| Molecular Formula | C26H37N7O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | N-cyclopropyl-4-[6-[2-[di(propan-2-yl)amino]ethylamino]-9-propan-2-ylpurin-8-yl]benzamide |
| SMILES | CC(C)N(CCNc1ncnc2c1nc(-c1ccc(C(=O)NC3CC3)cc1)n2C(C)C)C(C)C |
| InChI | InChI=1S/C26H37N7O/c1-16(2)32(17(3)4)14-13-27-23-22-25(29-15-28-23)33(18(5)6)24(31-22)19-7-9-20(10-8-19)26(34)30-21-11-12-21/h7-10,15-18,21H,11-14H2,1-6H3,(H,30,34)(H,27,28,29) |
| InChIKey | SXMIASMXLHNYGP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |