C21H26N6O — CID 68527878
N-cyclopropyl-4-methyl-3-[6-(2-methylbutylamino)purin-9-yl]benzamide (PubChem CID 68527878) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-[6-(2-methylbutylamino)purin-9-yl]benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-[6-(2-methylbutylamino)purin-9-yl]benzamide |
|---|---|
| PubChem CID | 68527878 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-[6-(2-methylbutylamino)purin-9-yl]benzamide |
| SMILES | CCC(C)CNc1ncnc2c1ncn2-c1cc(C(=O)NC2CC2)ccc1C |
| InChI | InChI=1S/C21H26N6O/c1-4-13(2)10-22-19-18-20(24-11-23-19)27(12-25-18)17-9-15(6-5-14(17)3)21(28)26-16-7-8-16/h5-6,9,11-13,16H,4,7-8,10H2,1-3H3,(H,26,28)(H,22,23,24) |
| InChIKey | XCKHPLQYSRTLFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |