C22H27N7O — CID 11531550
N-cyclopropyl-3-[6-(4-ethylpiperazin-1-yl)purin-9-yl]-4-methylbenzamide (PubChem CID 11531550) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is N-cyclopropyl-3-[6-(4-ethylpiperazin-1-yl)purin-9-yl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[6-(4-ethylpiperazin-1-yl)purin-9-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11531550 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-cyclopropyl-3-[6-(4-ethylpiperazin-1-yl)purin-9-yl]-4-methylbenzamide |
| SMILES | CCN1CCN(c2ncnc3c2ncn3-c2cc(C(=O)NC3CC3)ccc2C)CC1 |
| InChI | InChI=1S/C22H27N7O/c1-3-27-8-10-28(11-9-27)20-19-21(24-13-23-20)29(14-25-19)18-12-16(5-4-15(18)2)22(30)26-17-6-7-17/h4-5,12-14,17H,3,6-11H2,1-2H3,(H,26,30) |
| InChIKey | ZVDFLWRVRDVLIS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |