C27H28N6O2 — CID 143074273
3-[9-[3-(butan-2-ylcarbamoyl)phenyl]purin-6-yl]-N-cyclopropyl-4-methylbenzamide (PubChem CID 143074273) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 3-[9-[3-(butan-2-ylcarbamoyl)phenyl]purin-6-yl]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[9-[3-(butan-2-ylcarbamoyl)phenyl]purin-6-yl]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 143074273 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 3-[9-[3-(butan-2-ylcarbamoyl)phenyl]purin-6-yl]-N-cyclopropyl-4-methylbenzamide |
| SMILES | CCC(C)NC(=O)c1cccc(-n2cnc3c(-c4cc(C(=O)NC5CC5)ccc4C)ncnc32)c1 |
| InChI | InChI=1S/C27H28N6O2/c1-4-17(3)31-26(34)18-6-5-7-21(12-18)33-15-30-24-23(28-14-29-25(24)33)22-13-19(9-8-16(22)2)27(35)32-20-10-11-20/h5-9,12-15,17,20H,4,10-11H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | KNMTZNVGCOGIFX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |