C23H21N5O2 — CID 11502193
N-cyclopropyl-3-[6-[3-(hydroxymethyl)phenyl]purin-9-yl]-4-methylbenzamide (PubChem CID 11502193) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-cyclopropyl-3-[6-[3-(hydroxymethyl)phenyl]purin-9-yl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[6-[3-(hydroxymethyl)phenyl]purin-9-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11502193 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-cyclopropyl-3-[6-[3-(hydroxymethyl)phenyl]purin-9-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-n1cnc2c(-c3cccc(CO)c3)ncnc21 |
| InChI | InChI=1S/C23H21N5O2/c1-14-5-6-17(23(30)27-18-7-8-18)10-19(14)28-13-26-21-20(24-12-25-22(21)28)16-4-2-3-15(9-16)11-29/h2-6,9-10,12-13,18,29H,7-8,11H2,1H3,(H,27,30) |
| InChIKey | JJZBZNJBRUKTEJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |