C15H18N6O2S — CID 117085100
N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-4-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 117085100) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-4-ylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-4-ylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117085100 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[3-(2-oxopyrrolidin-1-yl)propyl]-2-(pyrimidin-4-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1csc(Nc2ccncn2)n1 |
| InChI | InChI=1S/C15H18N6O2S/c22-13-3-1-7-21(13)8-2-5-17-14(23)11-9-24-15(19-11)20-12-4-6-16-10-18-12/h4,6,9-10H,1-3,5,7-8H2,(H,17,23)(H,16,18,19,20) |
| InChIKey | QZAQBGXRWBPKOH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|