C12H19NO4 — CID 11708540
[(1R,3R,8S)-1-acetyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate (PubChem CID 11708540) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is [(1R,3R,8S)-1-acetyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate.
| Compound Name | [(1R,3R,8S)-1-acetyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11708540 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | [(1R,3R,8S)-1-acetyloxy-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](OC(C)=O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C12H19NO4/c1-8(14)16-7-10-6-12(17-9(2)15)11-4-3-5-13(10)11/h10-12H,3-7H2,1-2H3/t10-,11+,12-/m1/s1 |
| InChIKey | XUGPSHDJFPSVLZ-GRYCIOLGSA-N |
| XLogP | 0.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |