C14H20FNO6 — CID 134934722
[(5S,6R,7R,8R)-6,7-diacetyloxy-5-(fluoromethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate (PubChem CID 134934722) has the molecular formula C14H20FNO6 and a molecular weight of 317.31 g/mol. Its IUPAC name is [(5S,6R,7R,8R)-6,7-diacetyloxy-5-(fluoromethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate.
| Compound Name | [(5S,6R,7R,8R)-6,7-diacetyloxy-5-(fluoromethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate |
|---|---|
| PubChem CID | 134934722 |
| Molecular Formula | C14H20FNO6 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [(5S,6R,7R,8R)-6,7-diacetyloxy-5-(fluoromethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl] acetate |
| SMILES | CC(=O)OC1CCN2[C@H](CF)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C14H20FNO6/c1-7(17)20-11-4-5-16-10(6-15)13(21-8(2)18)14(12(11)16)22-9(3)19/h10-14H,4-6H2,1-3H3/t10-,11?,12-,13-,14-/m1/s1 |
| InChIKey | UDKAGNJZWMQJQM-ZRPXTJAYSA-N |
| XLogP | 0.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|