C34H34N6O4 — CID 117087767
2-[1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 117087767) has the molecular formula C34H34N6O4 and a molecular weight of 590.68 g/mol. Its IUPAC name is 2-[1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 117087767 |
| Molecular Formula | C34H34N6O4 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 2-[1-[6-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(Cc1cn(-c2ccc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)nn2)c2ccccc12)NCCOc1ccccc1 |
| InChI | InChI=1S/C34H34N6O4/c41-34(35-14-19-42-27-6-2-1-3-7-27)21-26-23-40(29-9-5-4-8-28(26)29)33-13-12-32(36-37-33)39-17-15-38(16-18-39)22-25-10-11-30-31(20-25)44-24-43-30/h1-13,20,23H,14-19,21-22,24H2,(H,35,41) |
| InChIKey | LDRIPHYSHCWILW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|