C26H23N7O2 — CID 117088263
N-(2-phenoxyethyl)-2-[1-[6-(pyrazin-2-ylamino)pyridazin-3-yl]indol-3-yl]acetamide (PubChem CID 117088263) has the molecular formula C26H23N7O2 and a molecular weight of 465.52 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-[1-[6-(pyrazin-2-ylamino)pyridazin-3-yl]indol-3-yl]acetamide.
| Compound Name | N-(2-phenoxyethyl)-2-[1-[6-(pyrazin-2-ylamino)pyridazin-3-yl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 117088263 |
| Molecular Formula | C26H23N7O2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-(2-phenoxyethyl)-2-[1-[6-(pyrazin-2-ylamino)pyridazin-3-yl]indol-3-yl]acetamide |
| SMILES | O=C(Cc1cn(-c2ccc(Nc3cnccn3)nn2)c2ccccc12)NCCOc1ccccc1 |
| InChI | InChI=1S/C26H23N7O2/c34-26(29-14-15-35-20-6-2-1-3-7-20)16-19-18-33(22-9-5-4-8-21(19)22)25-11-10-23(31-32-25)30-24-17-27-12-13-28-24/h1-13,17-18H,14-16H2,(H,29,34)(H,28,30,31) |
| InChIKey | BALZEAJVLKRJEM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|