C30H27N7O2 — CID 117093374
2-[1-[6-[(1-methylbenzimidazol-2-yl)amino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 117093374) has the molecular formula C30H27N7O2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-[1-[6-[(1-methylbenzimidazol-2-yl)amino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[1-[6-[(1-methylbenzimidazol-2-yl)amino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 117093374 |
| Molecular Formula | C30H27N7O2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 2-[1-[6-[(1-methylbenzimidazol-2-yl)amino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | Cn1c(Nc2ccc(-n3cc(CC(=O)NCCOc4ccccc4)c4ccccc43)nn2)nc2ccccc21 |
| InChI | InChI=1S/C30H27N7O2/c1-36-26-14-8-6-12-24(26)32-30(36)33-27-15-16-28(35-34-27)37-20-21(23-11-5-7-13-25(23)37)19-29(38)31-17-18-39-22-9-3-2-4-10-22/h2-16,20H,17-19H2,1H3,(H,31,38)(H,32,33,34) |
| InChIKey | OIMMVWKTQVIFOF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|