C31H26N6O2 — CID 117089055
2-[1-[6-(isoquinolin-1-ylamino)pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 117089055) has the molecular formula C31H26N6O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is 2-[1-[6-(isoquinolin-1-ylamino)pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[1-[6-(isoquinolin-1-ylamino)pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 117089055 |
| Molecular Formula | C31H26N6O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-[1-[6-(isoquinolin-1-ylamino)pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(Cc1cn(-c2ccc(Nc3nccc4ccccc34)nn2)c2ccccc12)NCCOc1ccccc1 |
| InChI | InChI=1S/C31H26N6O2/c38-30(32-18-19-39-24-9-2-1-3-10-24)20-23-21-37(27-13-7-6-11-25(23)27)29-15-14-28(35-36-29)34-31-26-12-5-4-8-22(26)16-17-33-31/h1-17,21H,18-20H2,(H,32,38)(H,33,34,35) |
| InChIKey | NBDUAJZGCPRENK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|