C30H30N6O2 — CID 117086977
2-[1-[6-[3-(dimethylamino)anilino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 117086977) has the molecular formula C30H30N6O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[1-[6-[3-(dimethylamino)anilino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[1-[6-[3-(dimethylamino)anilino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 117086977 |
| Molecular Formula | C30H30N6O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[1-[6-[3-(dimethylamino)anilino]pyridazin-3-yl]indol-3-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | CN(C)c1cccc(Nc2ccc(-n3cc(CC(=O)NCCOc4ccccc4)c4ccccc43)nn2)c1 |
| InChI | InChI=1S/C30H30N6O2/c1-35(2)24-10-8-9-23(20-24)32-28-15-16-29(34-33-28)36-21-22(26-13-6-7-14-27(26)36)19-30(37)31-17-18-38-25-11-4-3-5-12-25/h3-16,20-21H,17-19H2,1-2H3,(H,31,37)(H,32,33) |
| InChIKey | OSGZISMVZRHJAU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|