C23H23N3O4 — CID 117089739
N-(1,3-benzodioxol-5-yl)-2-[(4-hydroxycyclohexyl)amino]quinoline-4-carboxamide (PubChem CID 117089739) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(4-hydroxycyclohexyl)amino]quinoline-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(4-hydroxycyclohexyl)amino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 117089739 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(4-hydroxycyclohexyl)amino]quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc(NC2CCC(O)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H23N3O4/c27-16-8-5-14(6-9-16)24-22-12-18(17-3-1-2-4-19(17)26-22)23(28)25-15-7-10-20-21(11-15)30-13-29-20/h1-4,7,10-12,14,16,27H,5-6,8-9,13H2,(H,24,26)(H,25,28) |
| InChIKey | YATJXGHALJMCMN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |