C24H28N6O3S — CID 87633680
1-(1,3-benzodioxol-5-yl)-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]sulfanylurea (PubChem CID 87633680) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]sulfanylurea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]sulfanylurea |
|---|---|
| PubChem CID | 87633680 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[4-[[4-(dimethylamino)quinazolin-2-yl]amino]cyclohexyl]sulfanylurea |
| SMILES | CN(C)c1nc(NC2CCC(SNC(=O)Nc3ccc4c(c3)OCO4)CC2)nc2ccccc12 |
| InChI | InChI=1S/C24H28N6O3S/c1-30(2)22-18-5-3-4-6-19(18)27-23(28-22)25-15-7-10-17(11-8-15)34-29-24(31)26-16-9-12-20-21(13-16)33-14-32-20/h3-6,9,12-13,15,17H,7-8,10-11,14H2,1-2H3,(H,25,27,28)(H2,26,29,31) |
| InChIKey | RSCRBMLRGOFTEF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|