C8H10O2 — CID 117100359
8-oxatricyclo[3.2.1.02,4]oct-6-en-2-ylmethanol (PubChem CID 117100359) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 8-oxatricyclo[3.2.1.02,4]oct-6-en-2-ylmethanol.
| Compound Name | 8-oxatricyclo[3.2.1.02,4]oct-6-en-2-ylmethanol |
|---|---|
| PubChem CID | 117100359 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 8-oxatricyclo[3.2.1.02,4]oct-6-en-2-ylmethanol |
| SMILES | OCC12CC1C1C=CC2O1 |
| InChI | InChI=1S/C8H10O2/c9-4-8-3-5(8)6-1-2-7(8)10-6/h1-2,5-7,9H,3-4H2 |
| InChIKey | QTOPXGJQZXTJFP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|