C8H15NO4 — CID 10420003
(1R,2R,3S,4S,5S,6S)-5-amino-1-(hydroxymethyl)bicyclo[4.1.0]heptane-2,3,4-triol (PubChem CID 10420003) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S,6S)-5-amino-1-(hydroxymethyl)bicyclo[4.1.0]heptane-2,3,4-triol.
| Compound Name | (1R,2R,3S,4S,5S,6S)-5-amino-1-(hydroxymethyl)bicyclo[4.1.0]heptane-2,3,4-triol |
|---|---|
| PubChem CID | 10420003 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (1R,2R,3S,4S,5S,6S)-5-amino-1-(hydroxymethyl)bicyclo[4.1.0]heptane-2,3,4-triol |
| SMILES | N[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@]2(CO)C[C@H]12 |
| InChI | InChI=1S/C8H15NO4/c9-4-3-1-8(3,2-10)7(13)6(12)5(4)11/h3-7,10-13H,1-2,9H2/t3-,4+,5+,6-,7+,8+/m1/s1 |
| InChIKey | QOHPDHMUKXEACC-RZAHXXBXSA-N |
| XLogP | -2.59 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |