C10H21NO5 — CID 70927884
(2R,5S)-3-amino-2,5,6-tris(hydroxymethyl)-2,5-dimethyloxan-4-ol (PubChem CID 70927884) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (2R,5S)-3-amino-2,5,6-tris(hydroxymethyl)-2,5-dimethyloxan-4-ol.
| Compound Name | (2R,5S)-3-amino-2,5,6-tris(hydroxymethyl)-2,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 70927884 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2R,5S)-3-amino-2,5,6-tris(hydroxymethyl)-2,5-dimethyloxan-4-ol |
| SMILES | C[C@@]1(CO)C(CO)O[C@@](C)(CO)C(N)C1O |
| InChI | InChI=1S/C10H21NO5/c1-9(4-13)6(3-12)16-10(2,5-14)7(11)8(9)15/h6-8,12-15H,3-5,11H2,1-2H3/t6?,7?,8?,9-,10+/m1/s1 |
| InChIKey | RBHQNUAWBOBTRM-VCRKPGIOSA-N |
| XLogP | -2.18 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |