C9H11N3O3S — CID 117102632
3-morpholin-4-yl-6-sulfanylidene-1H-pyridazine-4-carboxylic acid (PubChem CID 117102632) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-morpholin-4-yl-6-sulfanylidene-1H-pyridazine-4-carboxylic acid.
| Compound Name | 3-morpholin-4-yl-6-sulfanylidene-1H-pyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 117102632 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 3-morpholin-4-yl-6-sulfanylidene-1H-pyridazine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(=S)[nH]nc1N1CCOCC1 |
| InChI | InChI=1S/C9H11N3O3S/c13-9(14)6-5-7(16)10-11-8(6)12-1-3-15-4-2-12/h5H,1-4H2,(H,10,16)(H,13,14) |
| InChIKey | KCAQHJUTMCCOMQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|