C18H10N6O4 — CID 11710529
6,7-dinitro-2,3-dipyridin-2-ylquinoxaline (PubChem CID 11710529) has the molecular formula C18H10N6O4 and a molecular weight of 374.32 g/mol. Its IUPAC name is 6,7-dinitro-2,3-dipyridin-2-ylquinoxaline.
| Compound Name | 6,7-dinitro-2,3-dipyridin-2-ylquinoxaline |
|---|---|
| PubChem CID | 11710529 |
| Molecular Formula | C18H10N6O4 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 6,7-dinitro-2,3-dipyridin-2-ylquinoxaline |
| SMILES | O=[N+]([O-])c1cc2nc(-c3ccccn3)c(-c3ccccn3)nc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H10N6O4/c25-23(26)15-9-13-14(10-16(15)24(27)28)22-18(12-6-2-4-8-20-12)17(21-13)11-5-1-3-7-19-11/h1-10H |
| InChIKey | SQBPARTXVGCYPK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 137.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|