4-fluoro-2,3-dimethylindazole-5-carboxylic acid

C10H9FN2O2 — CID 117110305

IUPAC4-fluoro-2,3-dimethylindazole-5-carboxylic acid
SMILESCc1c2c(F)c(C(=O)O)ccc2nn1C
InChIInChI=1S/C10H9FN2O2/c1-5-8-7(12-13(5)2)4-3-6(9(8)11)10(14)15/h3-4H,1-2H3,(H,14,15)
InChIKeySZQYILYPPFOVEM-UHFFFAOYSA-N
MW208.19 g/mol
LogP1.72
Rot. Bonds1

About 4-fluoro-2,3-dimethylindazole-5-carboxylic acid

4-fluoro-2,3-dimethylindazole-5-carboxylic acid (PubChem CID 117110305) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-fluoro-2,3-dimethylindazole-5-carboxylic acid.

Molecular Properties

Compound Name4-fluoro-2,3-dimethylindazole-5-carboxylic acid
PubChem CID117110305
Molecular FormulaC10H9FN2O2
Molecular Weight208.19 g/mol
Exact Mass208.06
IUPAC Name4-fluoro-2,3-dimethylindazole-5-carboxylic acid
SMILESCc1c2c(F)c(C(=O)O)ccc2nn1C
InChIInChI=1S/C10H9FN2O2/c1-5-8-7(12-13(5)2)4-3-6(9(8)11)10(14)15/h3-4H,1-2H3,(H,14,15)
InChIKeySZQYILYPPFOVEM-UHFFFAOYSA-N
XLogP1.72
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.19
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-fluoro-2,3-dimethylindazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-2,3-dimethylindazole-5-carboxylic acid?
The IUPAC name of 4-fluoro-2,3-dimethylindazole-5-carboxylic acid (CID 117110305) is 4-fluoro-2,3-dimethylindazole-5-carboxylic acid.
What is the SMILES notation for 4-fluoro-2,3-dimethylindazole-5-carboxylic acid?
The canonical SMILES for 4-fluoro-2,3-dimethylindazole-5-carboxylic acid is Cc1c2c(F)c(C(=O)O)ccc2nn1C.
What is the InChIKey of 4-fluoro-2,3-dimethylindazole-5-carboxylic acid?
The InChIKey is SZQYILYPPFOVEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2O2/c1-5-8-7(12-13(5)2)4-3-6(9(8)11)10(14)15/h3-4H,1-2H3,(H,14,15).
What are the key properties of 4-fluoro-2,3-dimethylindazole-5-carboxylic acid?
4-fluoro-2,3-dimethylindazole-5-carboxylic acid has a molecular weight of 208.19 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,3-dimethylindazole-5-carboxylic acid is sourced from PubChem (CID 117110305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).