C13H15N3O2 — CID 117110603
3-amino-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-1-carboxylic acid (PubChem CID 117110603) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-amino-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-1-carboxylic acid.
| Compound Name | 3-amino-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 117110603 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-amino-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-1-carboxylic acid |
| SMILES | Cn1c2c(c3ccccc31)CC(N)NC2C(=O)O |
| InChI | InChI=1S/C13H15N3O2/c1-16-9-5-3-2-4-7(9)8-6-10(14)15-11(12(8)16)13(17)18/h2-5,10-11,15H,6,14H2,1H3,(H,17,18) |
| InChIKey | PSKITDHXZIGSOH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|