C12H19NO — CID 117111308
4-(2-aminopropyl)-2,3,5-trimethylphenol (PubChem CID 117111308) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-(2-aminopropyl)-2,3,5-trimethylphenol.
| Compound Name | 4-(2-aminopropyl)-2,3,5-trimethylphenol |
|---|---|
| PubChem CID | 117111308 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-(2-aminopropyl)-2,3,5-trimethylphenol |
| SMILES | Cc1cc(O)c(C)c(C)c1CC(C)N |
| InChI | InChI=1S/C12H19NO/c1-7-5-12(14)10(4)9(3)11(7)6-8(2)13/h5,8,14H,6,13H2,1-4H3 |
| InChIKey | POYAEIQJRGVATM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |