C12H16O2 — CID 117117396
4-(1-hydroxycyclopropyl)-2,3,5-trimethylphenol (PubChem CID 117117396) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(1-hydroxycyclopropyl)-2,3,5-trimethylphenol.
| Compound Name | 4-(1-hydroxycyclopropyl)-2,3,5-trimethylphenol |
|---|---|
| PubChem CID | 117117396 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-(1-hydroxycyclopropyl)-2,3,5-trimethylphenol |
| SMILES | Cc1cc(O)c(C)c(C)c1C1(O)CC1 |
| InChI | InChI=1S/C12H16O2/c1-7-6-10(13)8(2)9(3)11(7)12(14)4-5-12/h6,13-14H,4-5H2,1-3H3 |
| InChIKey | BSPUEMJLFSTAHO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |