C13H19BrO2 — CID 117117637
3-(3-bromo-4-methoxy-2,5,6-trimethylphenyl)propan-1-ol (PubChem CID 117117637) has the molecular formula C13H19BrO2 and a molecular weight of 287.20 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxy-2,5,6-trimethylphenyl)propan-1-ol.
| Compound Name | 3-(3-bromo-4-methoxy-2,5,6-trimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 117117637 |
| Molecular Formula | C13H19BrO2 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-(3-bromo-4-methoxy-2,5,6-trimethylphenyl)propan-1-ol |
| SMILES | COc1c(C)c(C)c(CCCO)c(C)c1Br |
| InChI | InChI=1S/C13H19BrO2/c1-8-9(2)13(16-4)12(14)10(3)11(8)6-5-7-15/h15H,5-7H2,1-4H3 |
| InChIKey | QJOVSHBCTUDJGH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |