C26H49ClO3 — CID 11711957
methyl 8-[(2S,3S,4S,6R)-4-chloro-2,6-dihexyloxan-3-yl]octanoate (PubChem CID 11711957) has the molecular formula C26H49ClO3 and a molecular weight of 445.13 g/mol. Its IUPAC name is methyl 8-[(2S,3S,4S,6R)-4-chloro-2,6-dihexyloxan-3-yl]octanoate.
| Compound Name | methyl 8-[(2S,3S,4S,6R)-4-chloro-2,6-dihexyloxan-3-yl]octanoate |
|---|---|
| PubChem CID | 11711957 |
| Molecular Formula | C26H49ClO3 |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | methyl 8-[(2S,3S,4S,6R)-4-chloro-2,6-dihexyloxan-3-yl]octanoate |
| SMILES | CCCCCC[C@@H]1C[C@H](Cl)[C@@H](CCCCCCCC(=O)OC)[C@H](CCCCCC)O1 |
| InChI | InChI=1S/C26H49ClO3/c1-4-6-8-13-17-22-21-24(27)23(25(30-22)19-15-9-7-5-2)18-14-11-10-12-16-20-26(28)29-3/h22-25H,4-21H2,1-3H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | OKYSLUTUICAAMH-NGSHPTGOSA-N |
| XLogP | 8.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|