C14H17NO3 — CID 117125622
(4-methoxyphenyl) 2-(1,2,3,6-tetrahydropyridin-4-yl)acetate (PubChem CID 117125622) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(1,2,3,6-tetrahydropyridin-4-yl)acetate.
| Compound Name | (4-methoxyphenyl) 2-(1,2,3,6-tetrahydropyridin-4-yl)acetate |
|---|---|
| PubChem CID | 117125622 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (4-methoxyphenyl) 2-(1,2,3,6-tetrahydropyridin-4-yl)acetate |
| SMILES | COc1ccc(OC(=O)CC2=CCNCC2)cc1 |
| InChI | InChI=1S/C14H17NO3/c1-17-12-2-4-13(5-3-12)18-14(16)10-11-6-8-15-9-7-11/h2-6,15H,7-10H2,1H3 |
| InChIKey | YTUSXSANTCHERB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|