C17H24N2O3 — CID 167819604
N-[(2,5-dimethoxyphenyl)methyl]-N-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide (PubChem CID 167819604) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-N-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-N-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 167819604 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-N-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide |
| SMILES | COc1ccc(OC)c(CN(C)C(=O)CC2=CCNCC2)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-19(17(20)10-13-6-8-18-9-7-13)12-14-11-15(21-2)4-5-16(14)22-3/h4-6,11,18H,7-10,12H2,1-3H3 |
| InChIKey | JTLODMGKRXJDQO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|