C14H14F3NO2 — CID 117125660
[4-(trifluoromethyl)phenyl] 2-(1,2,3,6-tetrahydropyridin-5-yl)acetate (PubChem CID 117125660) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] 2-(1,2,3,6-tetrahydropyridin-5-yl)acetate.
| Compound Name | [4-(trifluoromethyl)phenyl] 2-(1,2,3,6-tetrahydropyridin-5-yl)acetate |
|---|---|
| PubChem CID | 117125660 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] 2-(1,2,3,6-tetrahydropyridin-5-yl)acetate |
| SMILES | O=C(CC1=CCCNC1)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)11-3-5-12(6-4-11)20-13(19)8-10-2-1-7-18-9-10/h2-6,18H,1,7-9H2 |
| InChIKey | BQYAEHTYJPVJBR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|