C8H8ClN3O — CID 117131064
2-(5-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanol (PubChem CID 117131064) has the molecular formula C8H8ClN3O and a molecular weight of 197.63 g/mol. Its IUPAC name is 2-(5-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanol.
| Compound Name | 2-(5-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanol |
|---|---|
| PubChem CID | 117131064 |
| Molecular Formula | C8H8ClN3O |
| Molecular Weight | 197.63 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-(5-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanol |
| SMILES | OCCc1nc2cccc(Cl)n2n1 |
| InChI | InChI=1S/C8H8ClN3O/c9-6-2-1-3-8-10-7(4-5-13)11-12(6)8/h1-3,13H,4-5H2 |
| InChIKey | HCJPODMAVFXTDJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.63 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|